C23H28F3N3OS — CID 166911999
N-(dimethylaminosulfanyl)-2-[1-(2-methylpropyl)-6-[4-(trifluoromethoxy)phenyl]indol-3-yl]ethanamine (PubChem CID 166911999) has the molecular formula C23H28F3N3OS and a molecular weight of 451.56 g/mol. Its IUPAC name is N-(dimethylaminosulfanyl)-2-[1-(2-methylpropyl)-6-[4-(trifluoromethoxy)phenyl]indol-3-yl]ethanamine.
| Compound Name | N-(dimethylaminosulfanyl)-2-[1-(2-methylpropyl)-6-[4-(trifluoromethoxy)phenyl]indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 166911999 |
| Molecular Formula | C23H28F3N3OS |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-(dimethylaminosulfanyl)-2-[1-(2-methylpropyl)-6-[4-(trifluoromethoxy)phenyl]indol-3-yl]ethanamine |
| SMILES | CC(C)Cn1cc(CCNSN(C)C)c2ccc(-c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C23H28F3N3OS/c1-16(2)14-29-15-19(11-12-27-31-28(3)4)21-10-7-18(13-22(21)29)17-5-8-20(9-6-17)30-23(24,25)26/h5-10,13,15-16,27H,11-12,14H2,1-4H3 |
| InChIKey | XZNUPVJDHFQIFJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|