C18H29FO9 — CID 166912396
[(2R)-4,5,6-triacetyloxy-2-fluoro-7-methoxy-3-methyloctyl] acetate (PubChem CID 166912396) has the molecular formula C18H29FO9 and a molecular weight of 408.42 g/mol. Its IUPAC name is [(2R)-4,5,6-triacetyloxy-2-fluoro-7-methoxy-3-methyloctyl] acetate.
| Compound Name | [(2R)-4,5,6-triacetyloxy-2-fluoro-7-methoxy-3-methyloctyl] acetate |
|---|---|
| PubChem CID | 166912396 |
| Molecular Formula | C18H29FO9 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(2R)-4,5,6-triacetyloxy-2-fluoro-7-methoxy-3-methyloctyl] acetate |
| SMILES | COC(C)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(C)[C@@H](F)COC(C)=O |
| InChI | InChI=1S/C18H29FO9/c1-9(15(19)8-25-11(3)20)16(26-12(4)21)18(28-14(6)23)17(10(2)24-7)27-13(5)22/h9-10,15-18H,8H2,1-7H3/t9?,10?,15-,16?,17?,18?/m0/s1 |
| InChIKey | SONAQAQDUZPVAW-FBYCWFPTSA-N |
| XLogP | 1.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|