About (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one
(Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one (PubChem CID 166912471) has the molecular formula C11H15F2NO
and a molecular weight of 215.24 g/mol. Its IUPAC name is (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one |
| PubChem CID | 166912471 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one |
| SMILES | C=C(/C=C\C)C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H15F2NO/c1-3-4-9(2)10(15)14-7-5-11(12,13)6-8-14/h3-4H,2,5-8H2,1H3/b4-3- |
| InChIKey | BKSCOYPMLNSVBX-ARJAWSKDSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one?
The IUPAC name of (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one (CID 166912471) is (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one.
What is the SMILES notation for (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one?
The canonical SMILES for (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one is C=C(/C=C\C)C(=O)N1CCC(F)(F)CC1.
What is the InChIKey of (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one?
The InChIKey is BKSCOYPMLNSVBX-ARJAWSKDSA-N. The full InChI is InChI=1S/C11H15F2NO/c1-3-4-9(2)10(15)14-7-5-11(12,13)6-8-14/h3-4H,2,5-8H2,1H3/b4-3-.
What are the key properties of (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one?
(Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one has a molecular weight of 215.24 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4,4-difluoropiperidin-1-yl)-2-methylidenepent-3-en-1-one is sourced from PubChem (CID 166912471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).