C14H19NO4 — CID 166912873
(2R,3R,4S,5S)-2-amino-5-[(1S)-1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-hydroxyethyl]oxolane-3,4-diol (PubChem CID 166912873) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-amino-5-[(1S)-1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-hydroxyethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-amino-5-[(1S)-1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-hydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 166912873 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2R,3R,4S,5S)-2-amino-5-[(1S)-1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-hydroxyethyl]oxolane-3,4-diol |
| SMILES | C[C@](O)(c1ccc2c(c1)CC2)[C@H]1O[C@@H](N)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO4/c1-14(18,12-10(16)11(17)13(15)19-12)9-5-4-7-2-3-8(7)6-9/h4-6,10-13,16-18H,2-3,15H2,1H3/t10-,11+,12-,13+,14-/m0/s1 |
| InChIKey | UHNUELVKBCKHRU-VJTDZRGJSA-N |
| XLogP | -0.60 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |