About (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one
(Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one (PubChem CID 166912991) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one |
| PubChem CID | 166912991 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one |
| SMILES | CO/C(=C\C(=O)C1CCC(C)(C)CC1)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C20H34O2/c1-19(2)10-6-15(7-11-19)17(21)14-18(22-5)16-8-12-20(3,4)13-9-16/h14-16H,6-13H2,1-5H3/b18-14- |
| InChIKey | ZNMBNVIYPCNLLW-JXAWBTAJSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one?
The IUPAC name of (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one (CID 166912991) is (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one.
What is the SMILES notation for (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one?
The canonical SMILES for (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one is CO/C(=C\C(=O)C1CCC(C)(C)CC1)C1CCC(C)(C)CC1.
What is the InChIKey of (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one?
The InChIKey is ZNMBNVIYPCNLLW-JXAWBTAJSA-N. The full InChI is InChI=1S/C20H34O2/c1-19(2)10-6-15(7-11-19)17(21)14-18(22-5)16-8-12-20(3,4)13-9-16/h14-16H,6-13H2,1-5H3/b18-14-.
What are the key properties of (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one?
(Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one has a molecular weight of 306.49 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-bis(4,4-dimethylcyclohexyl)-3-methoxyprop-2-en-1-one is sourced from PubChem (CID 166912991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).