C41H38N4O3 — CID 166913216
9-[2-[(4,6-ditert-butyl-1,3,5-triazin-2-yl)oxy]phenyl]-3,6-diphenoxycarbazole (PubChem CID 166913216) has the molecular formula C41H38N4O3 and a molecular weight of 634.78 g/mol. Its IUPAC name is 9-[2-[(4,6-ditert-butyl-1,3,5-triazin-2-yl)oxy]phenyl]-3,6-diphenoxycarbazole.
| Compound Name | 9-[2-[(4,6-ditert-butyl-1,3,5-triazin-2-yl)oxy]phenyl]-3,6-diphenoxycarbazole |
|---|---|
| PubChem CID | 166913216 |
| Molecular Formula | C41H38N4O3 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 9-[2-[(4,6-ditert-butyl-1,3,5-triazin-2-yl)oxy]phenyl]-3,6-diphenoxycarbazole |
| SMILES | CC(C)(C)c1nc(Oc2ccccc2-n2c3ccc(Oc4ccccc4)cc3c3cc(Oc4ccccc4)ccc32)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C41H38N4O3/c1-40(2,3)37-42-38(41(4,5)6)44-39(43-37)48-36-20-14-13-19-35(36)45-33-23-21-29(46-27-15-9-7-10-16-27)25-31(33)32-26-30(22-24-34(32)45)47-28-17-11-8-12-18-28/h7-26H,1-6H3 |
| InChIKey | KYKWPOVQLOVOGD-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |