About 4-(cyanomethyl)pyridine-2,6-dicarbonitrile
4-(cyanomethyl)pyridine-2,6-dicarbonitrile (PubChem CID 166913297) has the molecular formula C9H4N4
and a molecular weight of 168.16 g/mol. Its IUPAC name is 4-(cyanomethyl)pyridine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(cyanomethyl)pyridine-2,6-dicarbonitrile |
| PubChem CID | 166913297 |
| Molecular Formula | C9H4N4 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4-(cyanomethyl)pyridine-2,6-dicarbonitrile |
| SMILES | N#CCc1cc(C#N)nc(C#N)c1 |
| InChI | InChI=1S/C9H4N4/c10-2-1-7-3-8(5-11)13-9(4-7)6-12/h3-4H,1H2 |
| InChIKey | BUZOCUAZPJLJEE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(cyanomethyl)pyridine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyanomethyl)pyridine-2,6-dicarbonitrile?
The IUPAC name of 4-(cyanomethyl)pyridine-2,6-dicarbonitrile (CID 166913297) is 4-(cyanomethyl)pyridine-2,6-dicarbonitrile.
What is the SMILES notation for 4-(cyanomethyl)pyridine-2,6-dicarbonitrile?
The canonical SMILES for 4-(cyanomethyl)pyridine-2,6-dicarbonitrile is N#CCc1cc(C#N)nc(C#N)c1.
What is the InChIKey of 4-(cyanomethyl)pyridine-2,6-dicarbonitrile?
The InChIKey is BUZOCUAZPJLJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N4/c10-2-1-7-3-8(5-11)13-9(4-7)6-12/h3-4H,1H2.
What are the key properties of 4-(cyanomethyl)pyridine-2,6-dicarbonitrile?
4-(cyanomethyl)pyridine-2,6-dicarbonitrile has a molecular weight of 168.16 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyanomethyl)pyridine-2,6-dicarbonitrile is sourced from PubChem (CID 166913297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).