C26H29N4O10P2+ — CID 166913762
[(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 166913762) has the molecular formula C26H29N4O10P2+ and a molecular weight of 619.48 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 166913762 |
| Molecular Formula | C26H29N4O10P2+ |
| Molecular Weight | 619.48 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | [H]/N=c1/c2ccc([C@]3(C)O[C@H](CO[P+](=O)Oc4ccccc4)[C@@H](O)[C@H]3O)n2ncn1COP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C26H28N4O10P2/c1-26(24(32)23(31)21(39-26)15-36-41(33)40-19-10-6-3-7-11-19)22-13-12-20-25(27)29(16-28-30(20)22)17-38-42(34,35)37-14-18-8-4-2-5-9-18/h2-13,16,21,23-24,27,31-32H,14-15,17H2,1H3/p+1/b27-25-/t21-,23-,24-,26+/m1/s1 |
| InChIKey | NKZUYUZBDSVLSU-VJYNXDCUSA-O |
| XLogP | 3.00 |
| TPSA | 187.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|