C21H33NO10 — CID 166913873
4-[(2S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-3-hydroxybenzamide (PubChem CID 166913873) has the molecular formula C21H33NO10 and a molecular weight of 459.49 g/mol. Its IUPAC name is 4-[(2S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-3-hydroxybenzamide.
| Compound Name | 4-[(2S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 166913873 |
| Molecular Formula | C21H33NO10 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[(2S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-3-hydroxybenzamide |
| SMILES | CCOCCOCCOCCNC(=O)c1ccc(O[C@H]2C[C@@H](O)[C@@H](O)[C@@H](CO)O2)c(O)c1 |
| InChI | InChI=1S/C21H33NO10/c1-2-28-7-8-30-10-9-29-6-5-22-21(27)14-3-4-17(15(24)11-14)31-19-12-16(25)20(26)18(13-23)32-19/h3-4,11,16,18-20,23-26H,2,5-10,12-13H2,1H3,(H,22,27)/t16-,18-,19-,20-/m1/s1 |
| InChIKey | XGSNSKBSNMQLHZ-VBSBHUPXSA-N |
| XLogP | -0.60 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|