C23H33N5O — CID 166914042
(2,2,6,6-tetramethylpiperidin-4-yl) (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-methylphenyl]-4-iminobut-2-enimidate (PubChem CID 166914042) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-methylphenyl]-4-iminobut-2-enimidate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-methylphenyl]-4-iminobut-2-enimidate |
|---|---|
| PubChem CID | 166914042 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-methylphenyl]-4-iminobut-2-enimidate |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1ccc(C(=C/N)/C=N/[H])cc1C)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H33N5O/c1-15-10-16(17(13-24)14-25)6-7-19(15)20(26)8-9-21(27)29-18-11-22(2,3)28-23(4,5)12-18/h6-10,13-14,18,24,26-28H,11-12,25H2,1-5H3/b9-8-,17-14+,24-13+,26-20-,27-21- |
| InChIKey | MPYKYWPSNOAFPR-VLRPCSIPSA-N |
| XLogP | 4.17 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|