C18H29FN2 — CID 166914922
(Z)-1-(5-ethyl-2-fluorocyclohepta-1,3,6-trien-1-yl)-N,N,N',3,3-pentamethylbut-1-ene-1,4-diamine (PubChem CID 166914922) has the molecular formula C18H29FN2 and a molecular weight of 292.44 g/mol. Its IUPAC name is (Z)-1-(5-ethyl-2-fluorocyclohepta-1,3,6-trien-1-yl)-N,N,N',3,3-pentamethylbut-1-ene-1,4-diamine.
| Compound Name | (Z)-1-(5-ethyl-2-fluorocyclohepta-1,3,6-trien-1-yl)-N,N,N',3,3-pentamethylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 166914922 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (Z)-1-(5-ethyl-2-fluorocyclohepta-1,3,6-trien-1-yl)-N,N,N',3,3-pentamethylbut-1-ene-1,4-diamine |
| SMILES | CCC1C=CC(F)=C(/C(=C/C(C)(C)CNC)N(C)C)C=C1 |
| InChI | InChI=1S/C18H29FN2/c1-7-14-8-10-15(16(19)11-9-14)17(21(5)6)12-18(2,3)13-20-4/h8-12,14,20H,7,13H2,1-6H3/b17-12- |
| InChIKey | KQQYNXORKUFJPQ-ATVHPVEESA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |