C14H21N — CID 166915033
(6S)-5-[(1Z)-buta-1,3-dienyl]-4,7,7-trimethylspiro[2.4]hept-4-en-6-amine (PubChem CID 166915033) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (6S)-5-[(1Z)-buta-1,3-dienyl]-4,7,7-trimethylspiro[2.4]hept-4-en-6-amine.
| Compound Name | (6S)-5-[(1Z)-buta-1,3-dienyl]-4,7,7-trimethylspiro[2.4]hept-4-en-6-amine |
|---|---|
| PubChem CID | 166915033 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (6S)-5-[(1Z)-buta-1,3-dienyl]-4,7,7-trimethylspiro[2.4]hept-4-en-6-amine |
| SMILES | C=C/C=C\C1=C(C)C2(CC2)C(C)(C)[C@@H]1N |
| InChI | InChI=1S/C14H21N/c1-5-6-7-11-10(2)14(8-9-14)13(3,4)12(11)15/h5-7,12H,1,8-9,15H2,2-4H3/b7-6-/t12-/m1/s1 |
| InChIKey | JAXOCJOYFOALKU-ZHRWSRJISA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|