C11H15ClN2O — CID 166915934
[1-(3-chloro-4-methyl-2-pyridinyl)pyrrolidin-3-yl]methanol (PubChem CID 166915934) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is [1-(3-chloro-4-methyl-2-pyridinyl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(3-chloro-4-methyl-2-pyridinyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 166915934 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | [1-(3-chloro-4-methyl-2-pyridinyl)pyrrolidin-3-yl]methanol |
| SMILES | Cc1ccnc(N2CCC(CO)C2)c1Cl |
| InChI | InChI=1S/C11H15ClN2O/c1-8-2-4-13-11(10(8)12)14-5-3-9(6-14)7-15/h2,4,9,15H,3,5-7H2,1H3 |
| InChIKey | KPTOGABYEBEAQB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |