C18H26F6O2 — CID 166917732
(Z)-6,6,6-trifluoro-3-hydroxy-4-methyl-4-(2,2,2-trifluoroethyl)-1-(1,4,4-trimethylcyclohexyl)hex-2-en-1-one (PubChem CID 166917732) has the molecular formula C18H26F6O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-3-hydroxy-4-methyl-4-(2,2,2-trifluoroethyl)-1-(1,4,4-trimethylcyclohexyl)hex-2-en-1-one.
| Compound Name | (Z)-6,6,6-trifluoro-3-hydroxy-4-methyl-4-(2,2,2-trifluoroethyl)-1-(1,4,4-trimethylcyclohexyl)hex-2-en-1-one |
|---|---|
| PubChem CID | 166917732 |
| Molecular Formula | C18H26F6O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (Z)-6,6,6-trifluoro-3-hydroxy-4-methyl-4-(2,2,2-trifluoroethyl)-1-(1,4,4-trimethylcyclohexyl)hex-2-en-1-one |
| SMILES | CC1(C)CCC(C)(C(=O)/C=C(\O)C(C)(CC(F)(F)F)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F6O2/c1-14(2)5-7-15(3,8-6-14)12(25)9-13(26)16(4,10-17(19,20)21)11-18(22,23)24/h9,26H,5-8,10-11H2,1-4H3/b13-9- |
| InChIKey | RFJYVVZEDXGQEZ-LCYFTJDESA-N |
| XLogP | 6.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|