C21H36O2 — CID 166917743
(Z)-1-(1-ethylcyclohexyl)-3-methoxy-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one (PubChem CID 166917743) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (Z)-1-(1-ethylcyclohexyl)-3-methoxy-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one.
| Compound Name | (Z)-1-(1-ethylcyclohexyl)-3-methoxy-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 166917743 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (Z)-1-(1-ethylcyclohexyl)-3-methoxy-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one |
| SMILES | CCC1(C(=O)/C=C(\OC)C2(C)CCC(C)(C)CC2)CCCCC1 |
| InChI | InChI=1S/C21H36O2/c1-6-21(10-8-7-9-11-21)17(22)16-18(23-5)20(4)14-12-19(2,3)13-15-20/h16H,6-15H2,1-5H3/b18-16- |
| InChIKey | ZHQZQIYXITVVSN-VLGSPTGOSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|