C14H25N — CID 166917808
5-(3,5,5-trimethylhexan-3-yl)-2,3-dihydropyridine (PubChem CID 166917808) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 5-(3,5,5-trimethylhexan-3-yl)-2,3-dihydropyridine.
| Compound Name | 5-(3,5,5-trimethylhexan-3-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 166917808 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 5-(3,5,5-trimethylhexan-3-yl)-2,3-dihydropyridine |
| SMILES | CCC(C)(CC(C)(C)C)C1=CCCN=C1 |
| InChI | InChI=1S/C14H25N/c1-6-14(5,11-13(2,3)4)12-8-7-9-15-10-12/h8,10H,6-7,9,11H2,1-5H3 |
| InChIKey | VYKJRDHQPKHVTL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |