C19H18N6O3S — CID 166918333
N-[4-(3-cyano-5-methylsulfonylanilino)-5-(1-methylpyrazol-3-yl)-2-pyridinyl]acetamide (PubChem CID 166918333) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-[4-(3-cyano-5-methylsulfonylanilino)-5-(1-methylpyrazol-3-yl)-2-pyridinyl]acetamide.
| Compound Name | N-[4-(3-cyano-5-methylsulfonylanilino)-5-(1-methylpyrazol-3-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166918333 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[4-(3-cyano-5-methylsulfonylanilino)-5-(1-methylpyrazol-3-yl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2cc(C#N)cc(S(C)(=O)=O)c2)c(-c2ccn(C)n2)cn1 |
| InChI | InChI=1S/C19H18N6O3S/c1-12(26)22-19-9-18(16(11-21-19)17-4-5-25(2)24-17)23-14-6-13(10-20)7-15(8-14)29(3,27)28/h4-9,11H,1-3H3,(H2,21,22,23,26) |
| InChIKey | RCOQEHCRVBZJMU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |