C21H22FN5O5S — CID 166918750
N-[5-(5-fluoro-2-pyridinyl)-4-[[4-(2-methoxyethoxy)-6-methylsulfonyl-2-pyridinyl]amino]-2-pyridinyl]acetamide (PubChem CID 166918750) has the molecular formula C21H22FN5O5S and a molecular weight of 475.50 g/mol. Its IUPAC name is N-[5-(5-fluoro-2-pyridinyl)-4-[[4-(2-methoxyethoxy)-6-methylsulfonyl-2-pyridinyl]amino]-2-pyridinyl]acetamide.
| Compound Name | N-[5-(5-fluoro-2-pyridinyl)-4-[[4-(2-methoxyethoxy)-6-methylsulfonyl-2-pyridinyl]amino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166918750 |
| Molecular Formula | C21H22FN5O5S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[5-(5-fluoro-2-pyridinyl)-4-[[4-(2-methoxyethoxy)-6-methylsulfonyl-2-pyridinyl]amino]-2-pyridinyl]acetamide |
| SMILES | COCCOc1cc(Nc2cc(NC(C)=O)ncc2-c2ccc(F)cn2)nc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H22FN5O5S/c1-13(28)25-19-10-18(16(12-24-19)17-5-4-14(22)11-23-17)26-20-8-15(32-7-6-31-2)9-21(27-20)33(3,29)30/h4-5,8-12H,6-7H2,1-3H3,(H2,24,25,26,27,28) |
| InChIKey | ONLXYNNYTAPICQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|