About N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide
N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide (PubChem CID 166919314) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide |
| PubChem CID | 166919314 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide |
| SMILES | O=C(NCC(O)CO)C1=CC=CNC1 |
| InChI | InChI=1S/C9H14N2O3/c12-6-8(13)5-11-9(14)7-2-1-3-10-4-7/h1-3,8,10,12-13H,4-6H2,(H,11,14) |
| InChIKey | AWZCSALQSSWQEY-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide (CID 166919314) is N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide is O=C(NCC(O)CO)C1=CC=CNC1.
What is the InChIKey of N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide?
The InChIKey is AWZCSALQSSWQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c12-6-8(13)5-11-9(14)7-2-1-3-10-4-7/h1-3,8,10,12-13H,4-6H2,(H,11,14).
What are the key properties of N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide?
N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide has a molecular weight of 198.22 g/mol, XLogP of -1.50, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-1,2-dihydropyridine-3-carboxamide is sourced from PubChem (CID 166919314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).