C23H28ClFN4O2 — CID 166919333
[4-(6-chloro-5-fluorocyclohepta-1,3,5-trien-1-yl)piperidin-1-yl]-[5-(oxolan-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanone (PubChem CID 166919333) has the molecular formula C23H28ClFN4O2 and a molecular weight of 446.95 g/mol. Its IUPAC name is [4-(6-chloro-5-fluorocyclohepta-1,3,5-trien-1-yl)piperidin-1-yl]-[5-(oxolan-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanone.
| Compound Name | [4-(6-chloro-5-fluorocyclohepta-1,3,5-trien-1-yl)piperidin-1-yl]-[5-(oxolan-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 166919333 |
| Molecular Formula | C23H28ClFN4O2 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [4-(6-chloro-5-fluorocyclohepta-1,3,5-trien-1-yl)piperidin-1-yl]-[5-(oxolan-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CN(C1CCOC1)CC2)N1CCC(C2=CC=CC(F)=C(Cl)C2)CC1 |
| InChI | InChI=1S/C23H28ClFN4O2/c24-19-12-16(2-1-3-20(19)25)15-4-8-28(9-5-15)23(30)22-18-13-29(17-7-11-31-14-17)10-6-21(18)26-27-22/h1-3,15,17H,4-14H2,(H,26,27) |
| InChIKey | GNTDTMGIROGAAB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |