C21H23F5N4O — CID 166919512
1-[3-[[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone (PubChem CID 166919512) has the molecular formula C21H23F5N4O and a molecular weight of 442.43 g/mol. Its IUPAC name is 1-[3-[[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone.
| Compound Name | 1-[3-[[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 166919512 |
| Molecular Formula | C21H23F5N4O |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-[3-[[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(CN3CCC(c4cc(F)cc(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C21H23F5N4O/c1-12(31)30-7-4-15-18(27-28-19(15)11-30)10-29-5-2-13(3-6-29)16-8-14(22)9-17(23)20(16)21(24,25)26/h8-9,13H,2-7,10-11H2,1H3,(H,27,28) |
| InChIKey | SLKICEYAKCKHLW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |