C22H23F5N4O3 — CID 166919520
methyl 3-[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]azepane-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-6-carboxylate (PubChem CID 166919520) has the molecular formula C22H23F5N4O3 and a molecular weight of 486.44 g/mol. Its IUPAC name is methyl 3-[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]azepane-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]azepane-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 166919520 |
| Molecular Formula | C22H23F5N4O3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | methyl 3-[4-[3,5-difluoro-2-(trifluoromethyl)phenyl]azepane-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridine-6-carboxylate |
| SMILES | COC(=O)N1CCc2c(C(=O)N3CCCC(c4cc(F)cc(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C22H23F5N4O3/c1-34-21(33)31-8-5-14-17(11-31)28-29-19(14)20(32)30-6-2-3-12(4-7-30)15-9-13(23)10-16(24)18(15)22(25,26)27/h9-10,12H,2-8,11H2,1H3,(H,28,29) |
| InChIKey | WDTCPGANSJPLMA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |