About 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine
2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine (PubChem CID 166919564) has the molecular formula C10H11FN2
and a molecular weight of 178.21 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine.
Molecular Properties
| Compound Name | 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine |
| PubChem CID | 166919564 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine |
| SMILES | CC#CC1=CC(F)N/C(=N/C)C=C1 |
| InChI | InChI=1S/C10H11FN2/c1-3-4-8-5-6-10(12-2)13-9(11)7-8/h5-7,9H,1-2H3,(H,12,13) |
| InChIKey | SZGAPVROSVUENJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine?
The IUPAC name of 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine (CID 166919564) is 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine.
What is the SMILES notation for 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine?
The canonical SMILES for 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine is CC#CC1=CC(F)N/C(=N/C)C=C1.
What is the InChIKey of 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine?
The InChIKey is SZGAPVROSVUENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2/c1-3-4-8-5-6-10(12-2)13-9(11)7-8/h5-7,9H,1-2H3,(H,12,13).
What are the key properties of 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine?
2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine has a molecular weight of 178.21 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-methyl-4-prop-1-ynyl-1,2-dihydroazepin-7-imine is sourced from PubChem (CID 166919564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).