C18H20N2O — CID 166919749
[(3Z,5Z,7Z,8Z,10E)-10-cyano-5,7-di(ethylidene)dodeca-1,3,8,10-tetraen-2-yl] cyanate (PubChem CID 166919749) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is [(3Z,5Z,7Z,8Z,10E)-10-cyano-5,7-di(ethylidene)dodeca-1,3,8,10-tetraen-2-yl] cyanate.
| Compound Name | [(3Z,5Z,7Z,8Z,10E)-10-cyano-5,7-di(ethylidene)dodeca-1,3,8,10-tetraen-2-yl] cyanate |
|---|---|
| PubChem CID | 166919749 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [(3Z,5Z,7Z,8Z,10E)-10-cyano-5,7-di(ethylidene)dodeca-1,3,8,10-tetraen-2-yl] cyanate |
| SMILES | C=C(/C=C\C(=C/C)CC(/C=C\C(C#N)=C/C)=C/C)OC#N |
| InChI | InChI=1S/C18H20N2O/c1-5-16(9-8-15(4)21-14-20)12-17(6-2)10-11-18(7-3)13-19/h5-11H,4,12H2,1-3H3/b9-8-,11-10-,16-5+,17-6+,18-7+ |
| InChIKey | KDCNAKFHFBGMJV-CRTHEMPGSA-N |
| XLogP | 4.86 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|