C25H34O13 — CID 166921173
methyl (4R,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3-carboxylate (PubChem CID 166921173) has the molecular formula C25H34O13 and a molecular weight of 542.53 g/mol. Its IUPAC name is methyl (4R,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3-carboxylate.
| Compound Name | methyl (4R,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3-carboxylate |
|---|---|
| PubChem CID | 166921173 |
| Molecular Formula | C25H34O13 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | methyl (4R,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3-carboxylate |
| SMILES | C/C=C1/[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OCC(C(=O)OC)[C@H]1CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H34O13/c1-3-13-14(9-19(29)35-7-6-12-4-5-16(27)17(28)8-12)15(23(33)34-2)11-36-24(13)38-25-22(32)21(31)20(30)18(10-26)37-25/h3-5,8,14-15,18,20-22,24-28,30-32H,6-7,9-11H2,1-2H3/b13-3+/t14-,15?,18+,20+,21-,22+,24-,25-/m0/s1 |
| InChIKey | VHZPXGJDOFUSIR-JILSVUHMSA-N |
| XLogP | -0.90 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|