About 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline
9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline (PubChem CID 166921426) has the molecular formula C18H16N4
and a molecular weight of 288.35 g/mol. Its IUPAC name is 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline.
Molecular Properties
| Compound Name | 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline |
| PubChem CID | 166921426 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline |
| SMILES | Cc1cnc(-c2c(C)ccc3cn4ccnc4nc23)cc1C |
| InChI | InChI=1S/C18H16N4/c1-11-4-5-14-10-22-7-6-19-18(22)21-17(14)16(11)15-8-12(2)13(3)9-20-15/h4-10H,1-3H3 |
| InChIKey | VUFHLUWFDZHXOQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline?
The IUPAC name of 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline (CID 166921426) is 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline.
What is the SMILES notation for 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline?
The canonical SMILES for 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline is Cc1cnc(-c2c(C)ccc3cn4ccnc4nc23)cc1C.
What is the InChIKey of 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline?
The InChIKey is VUFHLUWFDZHXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4/c1-11-4-5-14-10-22-7-6-19-18(22)21-17(14)16(11)15-8-12(2)13(3)9-20-15/h4-10H,1-3H3.
What are the key properties of 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline?
9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline has a molecular weight of 288.35 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4,5-dimethyl-2-pyridinyl)-8-methylimidazo[2,1-b]quinazoline is sourced from PubChem (CID 166921426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).