C21H38N6O2 — CID 166921558
1-(2,4-dimethyl-1,2,3,4,6,8,9,9a-octahydropyrimido[1,6-a]pyrimidin-7-yl)-2-(2,4-dimethyl-1,5,9-triazaspiro[5.5]undecan-9-yl)ethane-1,2-dione (PubChem CID 166921558) has the molecular formula C21H38N6O2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,2,3,4,6,8,9,9a-octahydropyrimido[1,6-a]pyrimidin-7-yl)-2-(2,4-dimethyl-1,5,9-triazaspiro[5.5]undecan-9-yl)ethane-1,2-dione.
| Compound Name | 1-(2,4-dimethyl-1,2,3,4,6,8,9,9a-octahydropyrimido[1,6-a]pyrimidin-7-yl)-2-(2,4-dimethyl-1,5,9-triazaspiro[5.5]undecan-9-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 166921558 |
| Molecular Formula | C21H38N6O2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 1-(2,4-dimethyl-1,2,3,4,6,8,9,9a-octahydropyrimido[1,6-a]pyrimidin-7-yl)-2-(2,4-dimethyl-1,5,9-triazaspiro[5.5]undecan-9-yl)ethane-1,2-dione |
| SMILES | CC1CC(C)N2CN(C(=O)C(=O)N3CCC4(CC3)NC(C)CC(C)N4)CCC2N1 |
| InChI | InChI=1S/C21H38N6O2/c1-14-12-17(4)27-13-26(8-5-18(27)22-14)20(29)19(28)25-9-6-21(7-10-25)23-15(2)11-16(3)24-21/h14-18,22-24H,5-13H2,1-4H3 |
| InChIKey | DOTICNDSZSIDOZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|