About 5-chloro-4-fluoro-2,3-dimethylbenzonitrile
5-chloro-4-fluoro-2,3-dimethylbenzonitrile (PubChem CID 166921944) has the molecular formula C9H7ClFN
and a molecular weight of 183.61 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2,3-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 5-chloro-4-fluoro-2,3-dimethylbenzonitrile |
| PubChem CID | 166921944 |
| Molecular Formula | C9H7ClFN |
| Molecular Weight | 183.61 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 5-chloro-4-fluoro-2,3-dimethylbenzonitrile |
| SMILES | Cc1c(C#N)cc(Cl)c(F)c1C |
| InChI | InChI=1S/C9H7ClFN/c1-5-6(2)9(11)8(10)3-7(5)4-12/h3H,1-2H3 |
| InChIKey | SIPKLJANOHWDJM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-4-fluoro-2,3-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-fluoro-2,3-dimethylbenzonitrile?
The IUPAC name of 5-chloro-4-fluoro-2,3-dimethylbenzonitrile (CID 166921944) is 5-chloro-4-fluoro-2,3-dimethylbenzonitrile.
What is the SMILES notation for 5-chloro-4-fluoro-2,3-dimethylbenzonitrile?
The canonical SMILES for 5-chloro-4-fluoro-2,3-dimethylbenzonitrile is Cc1c(C#N)cc(Cl)c(F)c1C.
What is the InChIKey of 5-chloro-4-fluoro-2,3-dimethylbenzonitrile?
The InChIKey is SIPKLJANOHWDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClFN/c1-5-6(2)9(11)8(10)3-7(5)4-12/h3H,1-2H3.
What are the key properties of 5-chloro-4-fluoro-2,3-dimethylbenzonitrile?
5-chloro-4-fluoro-2,3-dimethylbenzonitrile has a molecular weight of 183.61 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-fluoro-2,3-dimethylbenzonitrile is sourced from PubChem (CID 166921944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).