C24H38FNS — CID 166922109
(4Z,13E)-15-[(Z)-but-2-en-2-yl]sulfanyl-11-ethyl-2-fluoro-N,14-dimethyl-8-methylidenepentadeca-4,9,13-trien-3-imine (PubChem CID 166922109) has the molecular formula C24H38FNS and a molecular weight of 391.64 g/mol. Its IUPAC name is (4Z,13E)-15-[(Z)-but-2-en-2-yl]sulfanyl-11-ethyl-2-fluoro-N,14-dimethyl-8-methylidenepentadeca-4,9,13-trien-3-imine.
| Compound Name | (4Z,13E)-15-[(Z)-but-2-en-2-yl]sulfanyl-11-ethyl-2-fluoro-N,14-dimethyl-8-methylidenepentadeca-4,9,13-trien-3-imine |
|---|---|
| PubChem CID | 166922109 |
| Molecular Formula | C24H38FNS |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | (4Z,13E)-15-[(Z)-but-2-en-2-yl]sulfanyl-11-ethyl-2-fluoro-N,14-dimethyl-8-methylidenepentadeca-4,9,13-trien-3-imine |
| SMILES | C=C(C=CC(CC)C/C=C(\C)CS/C(C)=C\C)CC/C=C\C(=N\C)C(C)F |
| InChI | InChI=1S/C24H38FNS/c1-8-21(5)27-18-20(4)15-17-23(9-2)16-14-19(3)12-10-11-13-24(26-7)22(6)25/h8,11,13-16,22-23H,3,9-10,12,17-18H2,1-2,4-7H3/b13-11-,16-14?,20-15+,21-8-,26-24- |
| InChIKey | OFSJWDIUSYLEJW-OKACLAHXSA-N |
| XLogP | 7.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|