C20H33NO — CID 166922119
1-[(2S)-2-[3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-1-en-2-yl]pyrrolidin-1-yl]propan-1-one (PubChem CID 166922119) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 1-[(2S)-2-[3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-1-en-2-yl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-[(2S)-2-[3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-1-en-2-yl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166922119 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 1-[(2S)-2-[3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-1-en-2-yl]pyrrolidin-1-yl]propan-1-one |
| SMILES | C=C(CC1CC2CCC1(C)C2(C)C)[C@@H]1CCCN1C(=O)CC |
| InChI | InChI=1S/C20H33NO/c1-6-18(22)21-11-7-8-17(21)14(2)12-16-13-15-9-10-20(16,5)19(15,3)4/h15-17H,2,6-13H2,1,3-5H3/t15?,16?,17-,20?/m0/s1 |
| InChIKey | ANIRGBJINNQXNH-AUDKGVNFSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|