About (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine
(2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine (PubChem CID 166922206) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine |
| PubChem CID | 166922206 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine |
| SMILES | C/C=C\C(\C=C/CC)=C(/C)N |
| InChI | InChI=1S/C10H17N/c1-4-6-8-10(7-5-2)9(3)11/h5-8H,4,11H2,1-3H3/b7-5-,8-6-,10-9- |
| InChIKey | QXQBOVBFOHBMJG-HDKJAUSJSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine?
The IUPAC name of (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine (CID 166922206) is (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine?
The canonical SMILES for (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine is C/C=C\C(\C=C/CC)=C(/C)N.
What is the InChIKey of (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine?
The InChIKey is QXQBOVBFOHBMJG-HDKJAUSJSA-N. The full InChI is InChI=1S/C10H17N/c1-4-6-8-10(7-5-2)9(3)11/h5-8H,4,11H2,1-3H3/b7-5-,8-6-,10-9-.
What are the key properties of (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine?
(2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine has a molecular weight of 151.25 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-amine is sourced from PubChem (CID 166922206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).