About (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine
(Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine (PubChem CID 166922272) has the molecular formula C8H12F2N2
and a molecular weight of 174.19 g/mol. Its IUPAC name is (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine |
| PubChem CID | 166922272 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine |
| SMILES | C=C(/N=C/C(=C\C)CN)C(F)F |
| InChI | InChI=1S/C8H12F2N2/c1-3-7(4-11)5-12-6(2)8(9)10/h3,5,8H,2,4,11H2,1H3/b7-3-,12-5+ |
| InChIKey | JTDSOEPYAXPPBK-GJOIUKJWSA-N |
| XLogP | 1.74 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine?
The IUPAC name of (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine (CID 166922272) is (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine.
What is the SMILES notation for (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine?
The canonical SMILES for (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine is C=C(/N=C/C(=C\C)CN)C(F)F.
What is the InChIKey of (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine?
The InChIKey is JTDSOEPYAXPPBK-GJOIUKJWSA-N. The full InChI is InChI=1S/C8H12F2N2/c1-3-7(4-11)5-12-6(2)8(9)10/h3,5,8H,2,4,11H2,1H3/b7-3-,12-5+.
What are the key properties of (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine?
(Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine has a molecular weight of 174.19 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,3-difluoroprop-1-en-2-yliminomethyl)but-2-en-1-amine is sourced from PubChem (CID 166922272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).