C15H21NS — CID 166922295
N-[(Z)-2-[(2E,4Z)-4-ethenyl-6-methylidenenona-2,4-dienyl]sulfanylethenyl]methanimine (PubChem CID 166922295) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is N-[(Z)-2-[(2E,4Z)-4-ethenyl-6-methylidenenona-2,4-dienyl]sulfanylethenyl]methanimine.
| Compound Name | N-[(Z)-2-[(2E,4Z)-4-ethenyl-6-methylidenenona-2,4-dienyl]sulfanylethenyl]methanimine |
|---|---|
| PubChem CID | 166922295 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[(Z)-2-[(2E,4Z)-4-ethenyl-6-methylidenenona-2,4-dienyl]sulfanylethenyl]methanimine |
| SMILES | C=CC(=C/C(=C)CCC)/C=C/CS/C=C\N=C |
| InChI | InChI=1S/C15H21NS/c1-5-8-14(3)13-15(6-2)9-7-11-17-12-10-16-4/h6-7,9-10,12-13H,2-5,8,11H2,1H3/b9-7+,12-10-,15-13- |
| InChIKey | AMUFPSMRPROCGK-CMCKWWOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|