C14H19F2N — CID 166922309
(2E,3Z)-5-(difluoromethyl)-2-ethylidene-N-[(3E)-penta-1,3-dien-2-yl]hexa-3,5-dien-1-amine (PubChem CID 166922309) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (2E,3Z)-5-(difluoromethyl)-2-ethylidene-N-[(3E)-penta-1,3-dien-2-yl]hexa-3,5-dien-1-amine.
| Compound Name | (2E,3Z)-5-(difluoromethyl)-2-ethylidene-N-[(3E)-penta-1,3-dien-2-yl]hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 166922309 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2E,3Z)-5-(difluoromethyl)-2-ethylidene-N-[(3E)-penta-1,3-dien-2-yl]hexa-3,5-dien-1-amine |
| SMILES | C=C(/C=C/C)NCC(/C=C\C(=C)C(F)F)=C/C |
| InChI | InChI=1S/C14H19F2N/c1-5-7-12(4)17-10-13(6-2)9-8-11(3)14(15)16/h5-9,14,17H,3-4,10H2,1-2H3/b7-5+,9-8-,13-6+ |
| InChIKey | ZMHUKUPPIVYZQT-JXZHAQIKSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|