C17H29N — CID 166922334
(3E,4Z,6E)-3-ethylidene-5-methyltetradeca-4,6-dien-2-imine (PubChem CID 166922334) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (3E,4Z,6E)-3-ethylidene-5-methyltetradeca-4,6-dien-2-imine.
| Compound Name | (3E,4Z,6E)-3-ethylidene-5-methyltetradeca-4,6-dien-2-imine |
|---|---|
| PubChem CID | 166922334 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (3E,4Z,6E)-3-ethylidene-5-methyltetradeca-4,6-dien-2-imine |
| SMILES | [H]/N=C(C)/C(/C=C(C)\C=C\CCCCCCC)=C/C |
| InChI | InChI=1S/C17H29N/c1-5-7-8-9-10-11-12-13-15(3)14-17(6-2)16(4)18/h6,12-14,18H,5,7-11H2,1-4H3/b13-12+,15-14-,17-6+,18-16+ |
| InChIKey | JVSPBKYTRAHWAO-MZVFSOGWSA-N |
| XLogP | 5.84 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|