C25H46N2 — CID 166922355
(5Z,7Z)-7-ethyl-N-[(E)-hex-2-enyl]-3-methyl-5-[2-[(2R)-piperidin-2-yl]ethyl]nona-5,7-dien-2-amine (PubChem CID 166922355) has the molecular formula C25H46N2 and a molecular weight of 374.66 g/mol. Its IUPAC name is (5Z,7Z)-7-ethyl-N-[(E)-hex-2-enyl]-3-methyl-5-[2-[(2R)-piperidin-2-yl]ethyl]nona-5,7-dien-2-amine.
| Compound Name | (5Z,7Z)-7-ethyl-N-[(E)-hex-2-enyl]-3-methyl-5-[2-[(2R)-piperidin-2-yl]ethyl]nona-5,7-dien-2-amine |
|---|---|
| PubChem CID | 166922355 |
| Molecular Formula | C25H46N2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.37 |
| IUPAC Name | (5Z,7Z)-7-ethyl-N-[(E)-hex-2-enyl]-3-methyl-5-[2-[(2R)-piperidin-2-yl]ethyl]nona-5,7-dien-2-amine |
| SMILES | C/C=C(\C=C(\CC[C@H]1CCCCN1)CC(C)C(C)NC/C=C/CCC)CC |
| InChI | InChI=1S/C25H46N2/c1-6-9-10-12-17-26-22(5)21(4)19-24(20-23(7-2)8-3)15-16-25-14-11-13-18-27-25/h7,10,12,20-22,25-27H,6,8-9,11,13-19H2,1-5H3/b12-10+,23-7-,24-20-/t21?,22?,25-/m1/s1 |
| InChIKey | MBVXXKFHEXMLDP-DVNQTGIMSA-N |
| XLogP | 6.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|