C19H30N2 — CID 166922542
8-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,9-diazatricyclo[9.4.0.02,4]pentadec-1(11)-ene (PubChem CID 166922542) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 8-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,9-diazatricyclo[9.4.0.02,4]pentadec-1(11)-ene.
| Compound Name | 8-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,9-diazatricyclo[9.4.0.02,4]pentadec-1(11)-ene |
|---|---|
| PubChem CID | 166922542 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 8-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,9-diazatricyclo[9.4.0.02,4]pentadec-1(11)-ene |
| SMILES | C/C=C\C(=C/C)C1NCCC2CC2C2=C(CCCC2)CN1 |
| InChI | InChI=1S/C19H30N2/c1-3-7-14(4-2)19-20-11-10-15-12-18(15)17-9-6-5-8-16(17)13-21-19/h3-4,7,15,18-21H,5-6,8-13H2,1-2H3/b7-3-,14-4+ |
| InChIKey | BFVOPQQEEHFXNY-NBUNBRBESA-N |
| XLogP | 3.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|