About 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine
2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine (PubChem CID 166922770) has the molecular formula C18H22N6S
and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine.
Molecular Properties
| Compound Name | 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine |
| PubChem CID | 166922770 |
| Molecular Formula | C18H22N6S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine |
| SMILES | Cc1cn2nc(/N=C/c3sc(C4CCNCC4)cc3N)cc(C)c2n1 |
| InChI | InChI=1S/C18H22N6S/c1-11-7-17(23-24-10-12(2)22-18(11)24)21-9-16-14(19)8-15(25-16)13-3-5-20-6-4-13/h7-10,13,20H,3-6,19H2,1-2H3/b21-9+ |
| InChIKey | LXZJMAZOEHCBRV-ZVBGSRNCSA-N |
| XLogP | 3.21 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine?
The IUPAC name of 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine (CID 166922770) is 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine.
What is the SMILES notation for 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine?
The canonical SMILES for 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine is Cc1cn2nc(/N=C/c3sc(C4CCNCC4)cc3N)cc(C)c2n1.
What is the InChIKey of 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine?
The InChIKey is LXZJMAZOEHCBRV-ZVBGSRNCSA-N. The full InChI is InChI=1S/C18H22N6S/c1-11-7-17(23-24-10-12(2)22-18(11)24)21-9-16-14(19)8-15(25-16)13-3-5-20-6-4-13/h7-10,13,20H,3-6,19H2,1-2H3/b21-9+.
What are the key properties of 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine?
2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine has a molecular weight of 354.48 g/mol, XLogP of 3.21, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)iminomethyl]-5-piperidin-4-ylthiophen-3-amine is sourced from PubChem (CID 166922770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).