C10H14N2O4 — CID 166923508
2-(2,5-dioxopyrrol-1-yl)-3-(propylamino)propanoic acid (PubChem CID 166923508) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-3-(propylamino)propanoic acid.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-3-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 166923508 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-3-(propylamino)propanoic acid |
| SMILES | CCCNCC(C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O4/c1-2-5-11-6-7(10(15)16)12-8(13)3-4-9(12)14/h3-4,7,11H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | LOVMLFZZXMYPLR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|