About 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine
3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine (PubChem CID 166923577) has the molecular formula C13H28F2N2O2
and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine.
Molecular Properties
| Compound Name | 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine |
| PubChem CID | 166923577 |
| Molecular Formula | C13H28F2N2O2 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine |
| SMILES | CC(C)OCCCNCCC(C)OCC(F)(F)CN |
| InChI | InChI=1S/C13H28F2N2O2/c1-11(2)18-8-4-6-17-7-5-12(3)19-10-13(14,15)9-16/h11-12,17H,4-10,16H2,1-3H3 |
| InChIKey | HWCYQDKNZQXLKT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine?
The IUPAC name of 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine (CID 166923577) is 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine.
What is the SMILES notation for 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine?
The canonical SMILES for 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine is CC(C)OCCCNCCC(C)OCC(F)(F)CN.
What is the InChIKey of 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine?
The InChIKey is HWCYQDKNZQXLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28F2N2O2/c1-11(2)18-8-4-6-17-7-5-12(3)19-10-13(14,15)9-16/h11-12,17H,4-10,16H2,1-3H3.
What are the key properties of 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine?
3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine has a molecular weight of 282.37 g/mol, XLogP of 1.78, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-2,2-difluoropropoxy)-N-(3-propan-2-yloxypropyl)butan-1-amine is sourced from PubChem (CID 166923577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).