About 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane
1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane (PubChem CID 166923633) has the molecular formula C11H18F4
and a molecular weight of 226.26 g/mol. Its IUPAC name is 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane.
Molecular Properties
| Compound Name | 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane |
| PubChem CID | 166923633 |
| Molecular Formula | C11H18F4 |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane |
| SMILES | CCCC1CC1(F)C(C)(CC)C(F)(F)F |
| InChI | InChI=1S/C11H18F4/c1-4-6-8-7-10(8,12)9(3,5-2)11(13,14)15/h8H,4-7H2,1-3H3 |
| InChIKey | VKNASOAPFYYICA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane?
The IUPAC name of 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane (CID 166923633) is 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane.
What is the SMILES notation for 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane?
The canonical SMILES for 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane is CCCC1CC1(F)C(C)(CC)C(F)(F)F.
What is the InChIKey of 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane?
The InChIKey is VKNASOAPFYYICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F4/c1-4-6-8-7-10(8,12)9(3,5-2)11(13,14)15/h8H,4-7H2,1-3H3.
What are the key properties of 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane?
1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane has a molecular weight of 226.26 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-propyl-1-(1,1,1-trifluoro-2-methylbutan-2-yl)cyclopropane is sourced from PubChem (CID 166923633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).