C14H10N4O5 — CID 166923720
3-(6,8-dihydroxy-2-oxopyrrolo[3,4-e]benzimidazol-7-yl)piperidine-2,6-dione (PubChem CID 166923720) has the molecular formula C14H10N4O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-(6,8-dihydroxy-2-oxopyrrolo[3,4-e]benzimidazol-7-yl)piperidine-2,6-dione.
| Compound Name | 3-(6,8-dihydroxy-2-oxopyrrolo[3,4-e]benzimidazol-7-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166923720 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-(6,8-dihydroxy-2-oxopyrrolo[3,4-e]benzimidazol-7-yl)piperidine-2,6-dione |
| SMILES | O=C1N=c2ccc3c(O)n(C4CCC(=O)NC4=O)c(O)c3c2=N1 |
| InChI | InChI=1S/C14H10N4O5/c19-8-4-3-7(11(20)16-8)18-12(21)5-1-2-6-10(9(5)13(18)22)17-14(23)15-6/h1-2,7,21-22H,3-4H2,(H,16,19,20) |
| InChIKey | SZTCHOLGJDDAQZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|