C24H44FN5O4 — CID 166923756
2-O-tert-butyl 3-O-(2-ethylbutyl) 6-fluoro-6-[(3Z)-3-hydrazinyl-3-hydrazinylidenepropyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate (PubChem CID 166923756) has the molecular formula C24H44FN5O4 and a molecular weight of 485.65 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-(2-ethylbutyl) 6-fluoro-6-[(3Z)-3-hydrazinyl-3-hydrazinylidenepropyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) 6-fluoro-6-[(3Z)-3-hydrazinyl-3-hydrazinylidenepropyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 166923756 |
| Molecular Formula | C24H44FN5O4 |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) 6-fluoro-6-[(3Z)-3-hydrazinyl-3-hydrazinylidenepropyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
| SMILES | CCC(CC)COC(=O)C1CC2CC(F)(CC/C(=N/N)NN)CCC2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44FN5O4/c1-6-16(7-2)15-33-21(31)19-12-18-13-24(25,11-9-20(28-26)29-27)10-8-17(18)14-30(19)22(32)34-23(3,4)5/h16-19H,6-15,26-27H2,1-5H3,(H,28,29) |
| InChIKey | AKXGQCQWBPVLHL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|