C15H27N — CID 166923759
(2E,4Z,6E)-N-butyl-N,5-dimethylnona-2,4,6-trien-2-amine (PubChem CID 166923759) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (2E,4Z,6E)-N-butyl-N,5-dimethylnona-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6E)-N-butyl-N,5-dimethylnona-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 166923759 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2E,4Z,6E)-N-butyl-N,5-dimethylnona-2,4,6-trien-2-amine |
| SMILES | CC/C=C/C(C)=C\C=C(/C)N(C)CCCC |
| InChI | InChI=1S/C15H27N/c1-6-8-10-14(3)11-12-15(4)16(5)13-9-7-2/h8,10-12H,6-7,9,13H2,1-5H3/b10-8+,14-11-,15-12+ |
| InChIKey | BRCVMHUXQNDJTC-FQGCSAPPSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|