C20H35NO2 — CID 166923928
ethyl (3S,6R)-3,4a,6-trimethyl-6-(3-methylbut-3-enyl)-2,4,5,7,8,8a-hexahydro-1H-isoquinoline-3-carboxylate (PubChem CID 166923928) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is ethyl (3S,6R)-3,4a,6-trimethyl-6-(3-methylbut-3-enyl)-2,4,5,7,8,8a-hexahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | ethyl (3S,6R)-3,4a,6-trimethyl-6-(3-methylbut-3-enyl)-2,4,5,7,8,8a-hexahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 166923928 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | ethyl (3S,6R)-3,4a,6-trimethyl-6-(3-methylbut-3-enyl)-2,4,5,7,8,8a-hexahydro-1H-isoquinoline-3-carboxylate |
| SMILES | C=C(C)CC[C@@]1(C)CCC2CN[C@](C)(C(=O)OCC)CC2(C)C1 |
| InChI | InChI=1S/C20H35NO2/c1-7-23-17(22)20(6)14-19(5)13-18(4,10-8-15(2)3)11-9-16(19)12-21-20/h16,21H,2,7-14H2,1,3-6H3/t16?,18-,19?,20-/m0/s1 |
| InChIKey | XANLMWZKFAYESR-YSNUMNBNSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|