About (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine
(4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine (PubChem CID 166924244) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine.
Molecular Properties
| Compound Name | (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine |
| PubChem CID | 166924244 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine |
| SMILES | N/N=C1/CCSc2ccccc2N1N |
| InChI | InChI=1S/C9H12N4S/c10-12-9-5-6-14-8-4-2-1-3-7(8)13(9)11/h1-4H,5-6,10-11H2/b12-9- |
| InChIKey | ANNFORHRRJMNIM-XFXZXTDPSA-N |
| XLogP | 1.13 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine?
The IUPAC name of (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine (CID 166924244) is (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine.
What is the SMILES notation for (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine?
The canonical SMILES for (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine is N/N=C1/CCSc2ccccc2N1N.
What is the InChIKey of (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine?
The InChIKey is ANNFORHRRJMNIM-XFXZXTDPSA-N. The full InChI is InChI=1S/C9H12N4S/c10-12-9-5-6-14-8-4-2-1-3-7(8)13(9)11/h1-4H,5-6,10-11H2/b12-9-.
What are the key properties of (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine?
(4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine has a molecular weight of 208.29 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydrazinylidene-2,3-dihydro-1,5-benzothiazepin-5-amine is sourced from PubChem (CID 166924244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).