About 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine
4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine (PubChem CID 166924420) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine.
Molecular Properties
| Compound Name | 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine |
| PubChem CID | 166924420 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine |
| SMILES | [H]/N=C1\CCOc2ccccc2N1N |
| InChI | InChI=1S/C9H11N3O/c10-9-5-6-13-8-4-2-1-3-7(8)12(9)11/h1-4,10H,5-6,11H2/b10-9+ |
| InChIKey | OHRVIEXWVPOBNH-MDZDMXLPSA-N |
| XLogP | 1.13 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine?
The IUPAC name of 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine (CID 166924420) is 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine.
What is the SMILES notation for 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine?
The canonical SMILES for 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine is [H]/N=C1\CCOc2ccccc2N1N.
What is the InChIKey of 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine?
The InChIKey is OHRVIEXWVPOBNH-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H11N3O/c10-9-5-6-13-8-4-2-1-3-7(8)12(9)11/h1-4,10H,5-6,11H2/b10-9+.
What are the key properties of 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine?
4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine has a molecular weight of 177.21 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2,3-dihydro-1,5-benzoxazepin-5-amine is sourced from PubChem (CID 166924420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).