C17H27N — CID 166924800
(1R)-N-[(3Z,5Z)-hepta-3,5-dienyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 166924800) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (1R)-N-[(3Z,5Z)-hepta-3,5-dienyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1R)-N-[(3Z,5Z)-hepta-3,5-dienyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 166924800 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (1R)-N-[(3Z,5Z)-hepta-3,5-dienyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | C/C=C\C=C/CC/N=C1\CC2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H27N/c1-5-6-7-8-9-12-18-15-13-14-10-11-17(15,4)16(14,2)3/h5-8,14H,9-13H2,1-4H3/b6-5-,8-7-,18-15+/t14?,17-/m0/s1 |
| InChIKey | NOEGEBBYMBVCEU-FVLTULFFSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|