About [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite
[1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite (PubChem CID 166925866) has the molecular formula C15H20F2N4O2S
and a molecular weight of 358.41 g/mol. Its IUPAC name is [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite.
Molecular Properties
| Compound Name | [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite |
| PubChem CID | 166925866 |
| Molecular Formula | C15H20F2N4O2S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite |
| SMILES | CNCC(CNc1cc(F)c(N2CC3(CSC3)C2)c(F)c1)ON=O |
| InChI | InChI=1S/C15H20F2N4O2S/c1-18-4-11(23-20-22)5-19-10-2-12(16)14(13(17)3-10)21-6-15(7-21)8-24-9-15/h2-3,11,18-19H,4-9H2,1H3 |
| InChIKey | YRGGHRBJWQRGGK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite?
The IUPAC name of [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite (CID 166925866) is [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite.
What is the SMILES notation for [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite?
The canonical SMILES for [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite is CNCC(CNc1cc(F)c(N2CC3(CSC3)C2)c(F)c1)ON=O.
What is the InChIKey of [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite?
The InChIKey is YRGGHRBJWQRGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N4O2S/c1-18-4-11(23-20-22)5-19-10-2-12(16)14(13(17)3-10)21-6-15(7-21)8-24-9-15/h2-3,11,18-19H,4-9H2,1H3.
What are the key properties of [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite?
[1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite has a molecular weight of 358.41 g/mol, XLogP of 2.22, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]-3-(methylamino)propan-2-yl] nitrite is sourced from PubChem (CID 166925866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).