About (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate
(2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate (PubChem CID 166926178) has the molecular formula C16H31NO3
and a molecular weight of 285.43 g/mol. Its IUPAC name is (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate |
| PubChem CID | 166926178 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate |
| SMILES | CC1CC(COC(=O)C(C)(CN)CC(C)(C)C)CCO1 |
| InChI | InChI=1S/C16H31NO3/c1-12-8-13(6-7-19-12)9-20-14(18)16(5,11-17)10-15(2,3)4/h12-13H,6-11,17H2,1-5H3 |
| InChIKey | JRJHKVYTPIRSAC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The IUPAC name of (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate (CID 166926178) is (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate.
What is the SMILES notation for (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The canonical SMILES for (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate is CC1CC(COC(=O)C(C)(CN)CC(C)(C)C)CCO1.
What is the InChIKey of (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The InChIKey is JRJHKVYTPIRSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3/c1-12-8-13(6-7-19-12)9-20-14(18)16(5,11-17)10-15(2,3)4/h12-13H,6-11,17H2,1-5H3.
What are the key properties of (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate?
(2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate has a molecular weight of 285.43 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyloxan-4-yl)methyl 2-(aminomethyl)-2,4,4-trimethylpentanoate is sourced from PubChem (CID 166926178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).